C35H35N3O5 — CID 165030007
(2R)-2-benzyl-N-[(2S)-4-(benzylamino)-3,4-dioxo-1-[(1S)-2-oxocyclopentyl]butan-2-yl]-4-(1H-indol-2-yl)-4-oxobutanamide (PubChem CID 165030007) has the molecular formula C35H35N3O5 and a molecular weight of 577.68 g/mol. Its IUPAC name is (2R)-2-benzyl-N-[(2S)-4-(benzylamino)-3,4-dioxo-1-[(1S)-2-oxocyclopentyl]butan-2-yl]-4-(1H-indol-2-yl)-4-oxobutanamide.
| Compound Name | (2R)-2-benzyl-N-[(2S)-4-(benzylamino)-3,4-dioxo-1-[(1S)-2-oxocyclopentyl]butan-2-yl]-4-(1H-indol-2-yl)-4-oxobutanamide |
|---|---|
| PubChem CID | 165030007 |
| Molecular Formula | C35H35N3O5 |
| Molecular Weight | 577.68 g/mol |
| Exact Mass | 577.26 |
| IUPAC Name | (2R)-2-benzyl-N-[(2S)-4-(benzylamino)-3,4-dioxo-1-[(1S)-2-oxocyclopentyl]butan-2-yl]-4-(1H-indol-2-yl)-4-oxobutanamide |
| SMILES | O=C(NCc1ccccc1)C(=O)[C@H](C[C@@H]1CCCC1=O)NC(=O)[C@@H](CC(=O)c1cc2ccccc2[nH]1)Cc1ccccc1 |
| InChI | InChI=1S/C35H35N3O5/c39-31-17-9-15-26(31)20-30(33(41)35(43)36-22-24-12-5-2-6-13-24)38-34(42)27(18-23-10-3-1-4-11-23)21-32(40)29-19-25-14-7-8-16-28(25)37-29/h1-8,10-14,16,19,26-27,30,37H,9,15,17-18,20-22H2,(H,36,43)(H,38,42)/t26-,27+,30-/m0/s1 |
| InChIKey | MMRQAIJLTYVMOD-DURBRWELSA-N |
| XLogP | 4.73 |
| TPSA | 125.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.68 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|