C33H36N4O5 — CID 163727003
(2S,4R)-N-[4-(benzylamino)-3,4-dioxo-1-[(1S)-2-oxocyclopentyl]butan-2-yl]-1-(1H-indole-2-carbonyl)-4-prop-2-enylpyrrolidine-2-carboxamide (PubChem CID 163727003) has the molecular formula C33H36N4O5 and a molecular weight of 568.67 g/mol. Its IUPAC name is (2S,4R)-N-[4-(benzylamino)-3,4-dioxo-1-[(1S)-2-oxocyclopentyl]butan-2-yl]-1-(1H-indole-2-carbonyl)-4-prop-2-enylpyrrolidine-2-carboxamide.
| Compound Name | (2S,4R)-N-[4-(benzylamino)-3,4-dioxo-1-[(1S)-2-oxocyclopentyl]butan-2-yl]-1-(1H-indole-2-carbonyl)-4-prop-2-enylpyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 163727003 |
| Molecular Formula | C33H36N4O5 |
| Molecular Weight | 568.67 g/mol |
| Exact Mass | 568.27 |
| IUPAC Name | (2S,4R)-N-[4-(benzylamino)-3,4-dioxo-1-[(1S)-2-oxocyclopentyl]butan-2-yl]-1-(1H-indole-2-carbonyl)-4-prop-2-enylpyrrolidine-2-carboxamide |
| SMILES | C=CC[C@@H]1C[C@@H](C(=O)NC(C[C@@H]2CCCC2=O)C(=O)C(=O)NCc2ccccc2)N(C(=O)c2cc3ccccc3[nH]2)C1 |
| InChI | InChI=1S/C33H36N4O5/c1-2-9-22-16-28(37(20-22)33(42)27-17-23-12-6-7-14-25(23)35-27)31(40)36-26(18-24-13-8-15-29(24)38)30(39)32(41)34-19-21-10-4-3-5-11-21/h2-7,10-12,14,17,22,24,26,28,35H,1,8-9,13,15-16,18-20H2,(H,34,41)(H,36,40)/t22-,24+,26?,28+/m1/s1 |
| InChIKey | SREGDJSPDPVHNE-OWYRHKKOSA-N |
| XLogP | 3.70 |
| TPSA | 128.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.67 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|