C32H35N5O5 — CID 166937077
(2S,4S)-N-[(3S)-1-(benzylamino)-1,2-dioxo-5-[(3R)-2-oxopyrrolidin-3-yl]pentan-3-yl]-4-ethenyl-1-(1H-indole-2-carbonyl)pyrrolidine-2-carboxamide (PubChem CID 166937077) has the molecular formula C32H35N5O5 and a molecular weight of 569.66 g/mol. Its IUPAC name is (2S,4S)-N-[(3S)-1-(benzylamino)-1,2-dioxo-5-[(3R)-2-oxopyrrolidin-3-yl]pentan-3-yl]-4-ethenyl-1-(1H-indole-2-carbonyl)pyrrolidine-2-carboxamide.
| Compound Name | (2S,4S)-N-[(3S)-1-(benzylamino)-1,2-dioxo-5-[(3R)-2-oxopyrrolidin-3-yl]pentan-3-yl]-4-ethenyl-1-(1H-indole-2-carbonyl)pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 166937077 |
| Molecular Formula | C32H35N5O5 |
| Molecular Weight | 569.66 g/mol |
| Exact Mass | 569.26 |
| IUPAC Name | (2S,4S)-N-[(3S)-1-(benzylamino)-1,2-dioxo-5-[(3R)-2-oxopyrrolidin-3-yl]pentan-3-yl]-4-ethenyl-1-(1H-indole-2-carbonyl)pyrrolidine-2-carboxamide |
| SMILES | C=C[C@@H]1C[C@@H](C(=O)N[C@@H](CC[C@@H]2CCNC2=O)C(=O)C(=O)NCc2ccccc2)N(C(=O)c2cc3ccccc3[nH]2)C1 |
| InChI | InChI=1S/C32H35N5O5/c1-2-20-16-27(37(19-20)32(42)26-17-23-10-6-7-11-24(23)35-26)30(40)36-25(13-12-22-14-15-33-29(22)39)28(38)31(41)34-18-21-8-4-3-5-9-21/h2-11,17,20,22,25,27,35H,1,12-16,18-19H2,(H,33,39)(H,34,41)(H,36,40)/t20-,22-,25+,27+/m1/s1 |
| InChIKey | DZMSQWQPIDDKSD-RYFPDZNGSA-N |
| XLogP | 2.47 |
| TPSA | 140.47 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.66 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|