C31H33N5O5 — CID 162695988
(2S,4S)-N-[(2S)-4-(benzylamino)-3,4-dioxo-1-[(3S)-2-oxopyrrolidin-3-yl]butan-2-yl]-4-ethenyl-1-(1H-indole-2-carbonyl)pyrrolidine-2-carboxamide (PubChem CID 162695988) has the molecular formula C31H33N5O5 and a molecular weight of 555.64 g/mol. Its IUPAC name is (2S,4S)-N-[(2S)-4-(benzylamino)-3,4-dioxo-1-[(3S)-2-oxopyrrolidin-3-yl]butan-2-yl]-4-ethenyl-1-(1H-indole-2-carbonyl)pyrrolidine-2-carboxamide.
| Compound Name | (2S,4S)-N-[(2S)-4-(benzylamino)-3,4-dioxo-1-[(3S)-2-oxopyrrolidin-3-yl]butan-2-yl]-4-ethenyl-1-(1H-indole-2-carbonyl)pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 162695988 |
| Molecular Formula | C31H33N5O5 |
| Molecular Weight | 555.64 g/mol |
| Exact Mass | 555.25 |
| IUPAC Name | (2S,4S)-N-[(2S)-4-(benzylamino)-3,4-dioxo-1-[(3S)-2-oxopyrrolidin-3-yl]butan-2-yl]-4-ethenyl-1-(1H-indole-2-carbonyl)pyrrolidine-2-carboxamide |
| SMILES | C=C[C@@H]1C[C@@H](C(=O)N[C@@H](C[C@@H]2CCNC2=O)C(=O)C(=O)NCc2ccccc2)N(C(=O)c2cc3ccccc3[nH]2)C1 |
| InChI | InChI=1S/C31H33N5O5/c1-2-19-14-26(36(18-19)31(41)25-15-21-10-6-7-11-23(21)34-25)29(39)35-24(16-22-12-13-32-28(22)38)27(37)30(40)33-17-20-8-4-3-5-9-20/h2-11,15,19,22,24,26,34H,1,12-14,16-18H2,(H,32,38)(H,33,40)(H,35,39)/t19-,22+,24+,26+/m1/s1 |
| InChIKey | WJIUCEPKSJBUAM-VWMGCSKSSA-N |
| XLogP | 2.08 |
| TPSA | 140.47 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.64 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|