C35H34FN3O5 — CID 165101539
(2R)-2-benzyl-N-[(2S)-4-(benzylamino)-3,4-dioxo-1-[(1S)-2-oxocyclopentyl]butan-2-yl]-4-(5-fluoro-1H-indol-2-yl)-4-oxobutanamide (PubChem CID 165101539) has the molecular formula C35H34FN3O5 and a molecular weight of 595.67 g/mol. Its IUPAC name is (2R)-2-benzyl-N-[(2S)-4-(benzylamino)-3,4-dioxo-1-[(1S)-2-oxocyclopentyl]butan-2-yl]-4-(5-fluoro-1H-indol-2-yl)-4-oxobutanamide.
| Compound Name | (2R)-2-benzyl-N-[(2S)-4-(benzylamino)-3,4-dioxo-1-[(1S)-2-oxocyclopentyl]butan-2-yl]-4-(5-fluoro-1H-indol-2-yl)-4-oxobutanamide |
|---|---|
| PubChem CID | 165101539 |
| Molecular Formula | C35H34FN3O5 |
| Molecular Weight | 595.67 g/mol |
| Exact Mass | 595.25 |
| IUPAC Name | (2R)-2-benzyl-N-[(2S)-4-(benzylamino)-3,4-dioxo-1-[(1S)-2-oxocyclopentyl]butan-2-yl]-4-(5-fluoro-1H-indol-2-yl)-4-oxobutanamide |
| SMILES | O=C(NCc1ccccc1)C(=O)[C@H](C[C@@H]1CCCC1=O)NC(=O)[C@@H](CC(=O)c1cc2cc(F)ccc2[nH]1)Cc1ccccc1 |
| InChI | InChI=1S/C35H34FN3O5/c36-27-14-15-28-25(17-27)19-29(38-28)32(41)20-26(16-22-8-3-1-4-9-22)34(43)39-30(18-24-12-7-13-31(24)40)33(42)35(44)37-21-23-10-5-2-6-11-23/h1-6,8-11,14-15,17,19,24,26,30,38H,7,12-13,16,18,20-21H2,(H,37,44)(H,39,43)/t24-,26+,30-/m0/s1 |
| InChIKey | YKHWJWTXHMDYMK-KIBIPHAFSA-N |
| XLogP | 4.87 |
| TPSA | 125.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.67 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|