C34H39FN4O5 — CID 164951486
(2R)-2-benzyl-N-[(2S)-4-(cyclohexylamino)-3,4-dioxo-1-[(3S)-2-oxopiperidin-3-yl]butan-2-yl]-4-(6-fluoro-1H-indol-2-yl)-4-oxobutanamide (PubChem CID 164951486) has the molecular formula C34H39FN4O5 and a molecular weight of 602.71 g/mol. Its IUPAC name is (2R)-2-benzyl-N-[(2S)-4-(cyclohexylamino)-3,4-dioxo-1-[(3S)-2-oxopiperidin-3-yl]butan-2-yl]-4-(6-fluoro-1H-indol-2-yl)-4-oxobutanamide.
| Compound Name | (2R)-2-benzyl-N-[(2S)-4-(cyclohexylamino)-3,4-dioxo-1-[(3S)-2-oxopiperidin-3-yl]butan-2-yl]-4-(6-fluoro-1H-indol-2-yl)-4-oxobutanamide |
|---|---|
| PubChem CID | 164951486 |
| Molecular Formula | C34H39FN4O5 |
| Molecular Weight | 602.71 g/mol |
| Exact Mass | 602.29 |
| IUPAC Name | (2R)-2-benzyl-N-[(2S)-4-(cyclohexylamino)-3,4-dioxo-1-[(3S)-2-oxopiperidin-3-yl]butan-2-yl]-4-(6-fluoro-1H-indol-2-yl)-4-oxobutanamide |
| SMILES | O=C(NC1CCCCC1)C(=O)[C@H](C[C@@H]1CCCNC1=O)NC(=O)[C@@H](CC(=O)c1cc2ccc(F)cc2[nH]1)Cc1ccccc1 |
| InChI | InChI=1S/C34H39FN4O5/c35-25-14-13-22-17-28(38-27(22)20-25)30(40)19-24(16-21-8-3-1-4-9-21)33(43)39-29(18-23-10-7-15-36-32(23)42)31(41)34(44)37-26-11-5-2-6-12-26/h1,3-4,8-9,13-14,17,20,23-24,26,29,38H,2,5-7,10-12,15-16,18-19H2,(H,36,42)(H,37,44)(H,39,43)/t23-,24+,29-/m0/s1 |
| InChIKey | APBIYWKUUOVQHW-IRYADYCUSA-N |
| XLogP | 4.16 |
| TPSA | 137.23 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.71 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|