C35H34N2O5S — CID 164957305
(2R)-4-(1-benzothiophen-2-yl)-2-benzyl-N-[(2S)-4-(benzylamino)-3,4-dioxo-1-[(1S)-2-oxocyclopentyl]butan-2-yl]-4-oxobutanamide (PubChem CID 164957305) has the molecular formula C35H34N2O5S and a molecular weight of 594.73 g/mol. Its IUPAC name is (2R)-4-(1-benzothiophen-2-yl)-2-benzyl-N-[(2S)-4-(benzylamino)-3,4-dioxo-1-[(1S)-2-oxocyclopentyl]butan-2-yl]-4-oxobutanamide.
| Compound Name | (2R)-4-(1-benzothiophen-2-yl)-2-benzyl-N-[(2S)-4-(benzylamino)-3,4-dioxo-1-[(1S)-2-oxocyclopentyl]butan-2-yl]-4-oxobutanamide |
|---|---|
| PubChem CID | 164957305 |
| Molecular Formula | C35H34N2O5S |
| Molecular Weight | 594.73 g/mol |
| Exact Mass | 594.22 |
| IUPAC Name | (2R)-4-(1-benzothiophen-2-yl)-2-benzyl-N-[(2S)-4-(benzylamino)-3,4-dioxo-1-[(1S)-2-oxocyclopentyl]butan-2-yl]-4-oxobutanamide |
| SMILES | O=C(NCc1ccccc1)C(=O)[C@H](C[C@@H]1CCCC1=O)NC(=O)[C@@H](CC(=O)c1cc2ccccc2s1)Cc1ccccc1 |
| InChI | InChI=1S/C35H34N2O5S/c38-29-16-9-15-25(29)19-28(33(40)35(42)36-22-24-12-5-2-6-13-24)37-34(41)27(18-23-10-3-1-4-11-23)20-30(39)32-21-26-14-7-8-17-31(26)43-32/h1-8,10-14,17,21,25,27-28H,9,15-16,18-20,22H2,(H,36,42)(H,37,41)/t25-,27+,28-/m0/s1 |
| InChIKey | BITBJOHJTOXJGK-ITHJLQSDSA-N |
| XLogP | 5.46 |
| TPSA | 109.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.73 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|