C19H30ClF4N5O5 — CID 167473245
(2S)-N-[(2S)-1-[2-(3-amino-3-oxopropyl)-2-(2-chloro-2-fluoroacetyl)hydrazinyl]-3,3-dimethyl-1-oxobutan-2-yl]-3,3-dimethyl-2-[(2,2,2-trifluoroacetyl)amino]butanamide (PubChem CID 167473245) has the molecular formula C19H30ClF4N5O5 and a molecular weight of 519.92 g/mol. Its IUPAC name is (2S)-N-[(2S)-1-[2-(3-amino-3-oxopropyl)-2-(2-chloro-2-fluoroacetyl)hydrazinyl]-3,3-dimethyl-1-oxobutan-2-yl]-3,3-dimethyl-2-[(2,2,2-trifluoroacetyl)amino]butanamide.
| Compound Name | (2S)-N-[(2S)-1-[2-(3-amino-3-oxopropyl)-2-(2-chloro-2-fluoroacetyl)hydrazinyl]-3,3-dimethyl-1-oxobutan-2-yl]-3,3-dimethyl-2-[(2,2,2-trifluoroacetyl)amino]butanamide |
|---|---|
| PubChem CID | 167473245 |
| Molecular Formula | C19H30ClF4N5O5 |
| Molecular Weight | 519.92 g/mol |
| Exact Mass | 519.19 |
| IUPAC Name | (2S)-N-[(2S)-1-[2-(3-amino-3-oxopropyl)-2-(2-chloro-2-fluoroacetyl)hydrazinyl]-3,3-dimethyl-1-oxobutan-2-yl]-3,3-dimethyl-2-[(2,2,2-trifluoroacetyl)amino]butanamide |
| SMILES | CC(C)(C)[C@H](NC(=O)[C@@H](NC(=O)C(F)(F)F)C(C)(C)C)C(=O)NN(CCC(N)=O)C(=O)C(F)Cl |
| InChI | InChI=1S/C19H30ClF4N5O5/c1-17(2,3)10(27-16(34)19(22,23)24)13(31)26-11(18(4,5)6)14(32)28-29(8-7-9(25)30)15(33)12(20)21/h10-12H,7-8H2,1-6H3,(H2,25,30)(H,26,31)(H,27,34)(H,28,32)/t10-,11-,12?/m1/s1 |
| InChIKey | RSJPAHUCBDGXDQ-XFKKCKKNSA-N |
| XLogP | 0.88 |
| TPSA | 150.70 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.92 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|