C14H23N5O7 — CID 88870447
ethyl (2R,3S)-3-[(2-amino-2-oxoethyl)-[2-(2-aminopropanoylamino)propanoylamino]carbamoyl]oxirane-2-carboxylate (PubChem CID 88870447) has the molecular formula C14H23N5O7 and a molecular weight of 373.37 g/mol. Its IUPAC name is ethyl (2R,3S)-3-[(2-amino-2-oxoethyl)-[2-(2-aminopropanoylamino)propanoylamino]carbamoyl]oxirane-2-carboxylate.
| Compound Name | ethyl (2R,3S)-3-[(2-amino-2-oxoethyl)-[2-(2-aminopropanoylamino)propanoylamino]carbamoyl]oxirane-2-carboxylate |
|---|---|
| PubChem CID | 88870447 |
| Molecular Formula | C14H23N5O7 |
| Molecular Weight | 373.37 g/mol |
| Exact Mass | 373.16 |
| IUPAC Name | ethyl (2R,3S)-3-[(2-amino-2-oxoethyl)-[2-(2-aminopropanoylamino)propanoylamino]carbamoyl]oxirane-2-carboxylate |
| SMILES | CCOC(=O)[C@@H]1O[C@@H]1C(=O)N(CC(N)=O)NC(=O)C(C)NC(=O)C(C)N |
| InChI | InChI=1S/C14H23N5O7/c1-4-25-14(24)10-9(26-10)13(23)19(5-8(16)20)18-12(22)7(3)17-11(21)6(2)15/h6-7,9-10H,4-5,15H2,1-3H3,(H2,16,20)(H,17,21)(H,18,22)/t6?,7?,9-,10+/m0/s1 |
| InChIKey | WEJFPZWTBROJEK-CPTYRYLOSA-N |
| XLogP | -3.49 |
| TPSA | 186.45 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.37 |
| LogP ≤ 5 | -3.49 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|