C22H30N4O8 — CID 10254486
3-[[[(2S)-2-[[(2S)-4-methyl-2-(phenylmethoxycarbonylamino)pentanoyl]amino]butanoyl]amino]carbamoyl]oxirane-2-carboxylic acid (PubChem CID 10254486) has the molecular formula C22H30N4O8 and a molecular weight of 478.50 g/mol. Its IUPAC name is 3-[[[(2S)-2-[[(2S)-4-methyl-2-(phenylmethoxycarbonylamino)pentanoyl]amino]butanoyl]amino]carbamoyl]oxirane-2-carboxylic acid.
| Compound Name | 3-[[[(2S)-2-[[(2S)-4-methyl-2-(phenylmethoxycarbonylamino)pentanoyl]amino]butanoyl]amino]carbamoyl]oxirane-2-carboxylic acid |
|---|---|
| PubChem CID | 10254486 |
| Molecular Formula | C22H30N4O8 |
| Molecular Weight | 478.50 g/mol |
| Exact Mass | 478.21 |
| IUPAC Name | 3-[[[(2S)-2-[[(2S)-4-methyl-2-(phenylmethoxycarbonylamino)pentanoyl]amino]butanoyl]amino]carbamoyl]oxirane-2-carboxylic acid |
| SMILES | CC[C@H](NC(=O)[C@H](CC(C)C)NC(=O)OCc1ccccc1)C(=O)NNC(=O)C1OC1C(=O)O |
| InChI | InChI=1S/C22H30N4O8/c1-4-14(19(28)25-26-20(29)16-17(34-16)21(30)31)23-18(27)15(10-12(2)3)24-22(32)33-11-13-8-6-5-7-9-13/h5-9,12,14-17H,4,10-11H2,1-3H3,(H,23,27)(H,24,32)(H,25,28)(H,26,29)(H,30,31)/t14-,15-,16?,17?/m0/s1 |
| InChIKey | KUZLWKDQBVUGFU-JUVOFCAFSA-N |
| XLogP | 0.22 |
| TPSA | 175.46 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.50 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|