C28H29N3O5 — CID 10368186
benzyl N-[(2S)-1-oxo-3-phenyl-1-[2-[3-(2-phenylethyl)oxirane-2-carbonyl]hydrazinyl]propan-2-yl]carbamate (PubChem CID 10368186) has the molecular formula C28H29N3O5 and a molecular weight of 487.56 g/mol. Its IUPAC name is benzyl N-[(2S)-1-oxo-3-phenyl-1-[2-[3-(2-phenylethyl)oxirane-2-carbonyl]hydrazinyl]propan-2-yl]carbamate.
| Compound Name | benzyl N-[(2S)-1-oxo-3-phenyl-1-[2-[3-(2-phenylethyl)oxirane-2-carbonyl]hydrazinyl]propan-2-yl]carbamate |
|---|---|
| PubChem CID | 10368186 |
| Molecular Formula | C28H29N3O5 |
| Molecular Weight | 487.56 g/mol |
| Exact Mass | 487.21 |
| IUPAC Name | benzyl N-[(2S)-1-oxo-3-phenyl-1-[2-[3-(2-phenylethyl)oxirane-2-carbonyl]hydrazinyl]propan-2-yl]carbamate |
| SMILES | O=C(N[C@@H](Cc1ccccc1)C(=O)NNC(=O)C1OC1CCc1ccccc1)OCc1ccccc1 |
| InChI | InChI=1S/C28H29N3O5/c32-26(30-31-27(33)25-24(36-25)17-16-20-10-4-1-5-11-20)23(18-21-12-6-2-7-13-21)29-28(34)35-19-22-14-8-3-9-15-22/h1-15,23-25H,16-19H2,(H,29,34)(H,30,32)(H,31,33)/t23-,24?,25?/m0/s1 |
| InChIKey | JGOPXSVVAUUQBV-KAVZGVEFSA-N |
| XLogP | 3.07 |
| TPSA | 109.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.56 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|