C10H16O6 — CID 163982638
ethyl (4S,5S)-5-acetyl-2-ethoxy-1,3-dioxolane-4-carboxylate (PubChem CID 163982638) has the molecular formula C10H16O6 and a molecular weight of 232.23 g/mol. Its IUPAC name is ethyl (4S,5S)-5-acetyl-2-ethoxy-1,3-dioxolane-4-carboxylate.
| Compound Name | ethyl (4S,5S)-5-acetyl-2-ethoxy-1,3-dioxolane-4-carboxylate |
|---|---|
| PubChem CID | 163982638 |
| Molecular Formula | C10H16O6 |
| Molecular Weight | 232.23 g/mol |
| Exact Mass | 232.09 |
| IUPAC Name | ethyl (4S,5S)-5-acetyl-2-ethoxy-1,3-dioxolane-4-carboxylate |
| SMILES | CCOC(=O)[C@H]1OC(OCC)O[C@@H]1C(C)=O |
| InChI | InChI=1S/C10H16O6/c1-4-13-9(12)8-7(6(3)11)15-10(16-8)14-5-2/h7-8,10H,4-5H2,1-3H3/t7-,8+,10?/m1/s1 |
| InChIKey | XVPZEVVJQYCNAB-HHCGNCNQSA-N |
| XLogP | 0.24 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.23 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |