(3R,4S,5S)-5-(aminomethyl)-3,4-dimethyloxolane-2-carboxylic acid

C8H15NO3 — CID 59036333

IUPAC(3R,4S,5S)-5-(aminomethyl)-3,4-dimethyloxolane-2-carboxylic acid
SMILESC[C@@H]1[C@@H](CN)OC(C(=O)O)[C@@H]1C
InChIInChI=1S/C8H15NO3/c1-4-5(2)7(8(10)11)12-6(4)3-9/h4-7H,3,9H2,1-2H3,(H,10,11)/t4-,5+,6+,7?/m0/s1
InChIKeyZSJLYRGUKZOWLF-CUWOBHIPSA-N
MW173.21 g/mol
LogP0.07
Rot. Bonds2

About (3R,4S,5S)-5-(aminomethyl)-3,4-dimethyloxolane-2-carboxylic acid

(3R,4S,5S)-5-(aminomethyl)-3,4-dimethyloxolane-2-carboxylic acid (PubChem CID 59036333) has the molecular formula C8H15NO3 and a molecular weight of 173.21 g/mol. Its IUPAC name is (3R,4S,5S)-5-(aminomethyl)-3,4-dimethyloxolane-2-carboxylic acid.

Molecular Properties

Compound Name(3R,4S,5S)-5-(aminomethyl)-3,4-dimethyloxolane-2-carboxylic acid
PubChem CID59036333
Molecular FormulaC8H15NO3
Molecular Weight173.21 g/mol
Exact Mass173.11
IUPAC Name(3R,4S,5S)-5-(aminomethyl)-3,4-dimethyloxolane-2-carboxylic acid
SMILESC[C@@H]1[C@@H](CN)OC(C(=O)O)[C@@H]1C
InChIInChI=1S/C8H15NO3/c1-4-5(2)7(8(10)11)12-6(4)3-9/h4-7H,3,9H2,1-2H3,(H,10,11)/t4-,5+,6+,7?/m0/s1
InChIKeyZSJLYRGUKZOWLF-CUWOBHIPSA-N
XLogP0.07
TPSA72.55 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds2
Heavy Atoms12
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500173.21
LogP ≤ 50.07
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Analyze (3R,4S,5S)-5-(aminomethyl)-3,4-dimethyloxolane-2-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (3R,4S,5S)-5-(aminomethyl)-3,4-dimethyloxolane-2-carboxylic acid?
The IUPAC name of (3R,4S,5S)-5-(aminomethyl)-3,4-dimethyloxolane-2-carboxylic acid (CID 59036333) is (3R,4S,5S)-5-(aminomethyl)-3,4-dimethyloxolane-2-carboxylic acid.
What is the SMILES notation for (3R,4S,5S)-5-(aminomethyl)-3,4-dimethyloxolane-2-carboxylic acid?
The canonical SMILES for (3R,4S,5S)-5-(aminomethyl)-3,4-dimethyloxolane-2-carboxylic acid is C[C@@H]1[C@@H](CN)OC(C(=O)O)[C@@H]1C.
What is the InChIKey of (3R,4S,5S)-5-(aminomethyl)-3,4-dimethyloxolane-2-carboxylic acid?
The InChIKey is ZSJLYRGUKZOWLF-CUWOBHIPSA-N. The full InChI is InChI=1S/C8H15NO3/c1-4-5(2)7(8(10)11)12-6(4)3-9/h4-7H,3,9H2,1-2H3,(H,10,11)/t4-,5+,6+,7?/m0/s1.
What are the key properties of (3R,4S,5S)-5-(aminomethyl)-3,4-dimethyloxolane-2-carboxylic acid?
(3R,4S,5S)-5-(aminomethyl)-3,4-dimethyloxolane-2-carboxylic acid has a molecular weight of 173.21 g/mol, XLogP of 0.07, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3R,4S,5S)-5-(aminomethyl)-3,4-dimethyloxolane-2-carboxylic acid is sourced from PubChem (CID 59036333), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).