C12H20FNO4 — CID 59036484
(2R,3R,4S,5R,6S)-6-[(fluoromethoxymethylideneamino)methyl]-3,4,5-trimethyloxane-2-carboxylic acid (PubChem CID 59036484) has the molecular formula C12H20FNO4 and a molecular weight of 261.29 g/mol. Its IUPAC name is (2R,3R,4S,5R,6S)-6-[(fluoromethoxymethylideneamino)methyl]-3,4,5-trimethyloxane-2-carboxylic acid.
| Compound Name | (2R,3R,4S,5R,6S)-6-[(fluoromethoxymethylideneamino)methyl]-3,4,5-trimethyloxane-2-carboxylic acid |
|---|---|
| PubChem CID | 59036484 |
| Molecular Formula | C12H20FNO4 |
| Molecular Weight | 261.29 g/mol |
| Exact Mass | 261.14 |
| IUPAC Name | (2R,3R,4S,5R,6S)-6-[(fluoromethoxymethylideneamino)methyl]-3,4,5-trimethyloxane-2-carboxylic acid |
| SMILES | C[C@H]1[C@@H](C)[C@@H](C/N=C/OCF)O[C@@H](C(=O)O)[C@@H]1C |
| InChI | InChI=1S/C12H20FNO4/c1-7-8(2)10(4-14-6-17-5-13)18-11(9(7)3)12(15)16/h6-11H,4-5H2,1-3H3,(H,15,16)/b14-6+/t7-,8+,9+,10+,11+/m0/s1 |
| InChIKey | LMZCQOBEBDEPOB-JZXMKOBPSA-N |
| XLogP | 1.72 |
| TPSA | 68.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.29 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|