C12H21N3O3 — CID 59036533
ethyl (2R,3R,4S,5S,6S)-6-(azidomethyl)-3,4,5-trimethyloxane-2-carboxylate (PubChem CID 59036533) has the molecular formula C12H21N3O3 and a molecular weight of 255.32 g/mol. Its IUPAC name is ethyl (2R,3R,4S,5S,6S)-6-(azidomethyl)-3,4,5-trimethyloxane-2-carboxylate.
| Compound Name | ethyl (2R,3R,4S,5S,6S)-6-(azidomethyl)-3,4,5-trimethyloxane-2-carboxylate |
|---|---|
| PubChem CID | 59036533 |
| Molecular Formula | C12H21N3O3 |
| Molecular Weight | 255.32 g/mol |
| Exact Mass | 255.16 |
| IUPAC Name | ethyl (2R,3R,4S,5S,6S)-6-(azidomethyl)-3,4,5-trimethyloxane-2-carboxylate |
| SMILES | CCOC(=O)[C@@H]1O[C@H](CN=[N+]=[N-])[C@@H](C)[C@H](C)[C@H]1C |
| InChI | InChI=1S/C12H21N3O3/c1-5-17-12(16)11-9(4)7(2)8(3)10(18-11)6-14-15-13/h7-11H,5-6H2,1-4H3/t7-,8-,9+,10+,11+/m0/s1 |
| InChIKey | NFUMWGUGMKRKMZ-FBDQPXRJSA-N |
| XLogP | 2.54 |
| TPSA | 84.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.32 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|