C13H23NO5 — CID 59036447
ethyl (2R,3R,4S,5S,6S)-3-acetamido-6-(hydroxymethyl)-4,5-dimethyloxane-2-carboxylate (PubChem CID 59036447) has the molecular formula C13H23NO5 and a molecular weight of 273.33 g/mol. Its IUPAC name is ethyl (2R,3R,4S,5S,6S)-3-acetamido-6-(hydroxymethyl)-4,5-dimethyloxane-2-carboxylate.
| Compound Name | ethyl (2R,3R,4S,5S,6S)-3-acetamido-6-(hydroxymethyl)-4,5-dimethyloxane-2-carboxylate |
|---|---|
| PubChem CID | 59036447 |
| Molecular Formula | C13H23NO5 |
| Molecular Weight | 273.33 g/mol |
| Exact Mass | 273.16 |
| IUPAC Name | ethyl (2R,3R,4S,5S,6S)-3-acetamido-6-(hydroxymethyl)-4,5-dimethyloxane-2-carboxylate |
| SMILES | CCOC(=O)[C@@H]1O[C@H](CO)[C@@H](C)[C@H](C)[C@H]1NC(C)=O |
| InChI | InChI=1S/C13H23NO5/c1-5-18-13(17)12-11(14-9(4)16)8(3)7(2)10(6-15)19-12/h7-8,10-12,15H,5-6H2,1-4H3,(H,14,16)/t7-,8-,10+,11+,12+/m0/s1 |
| InChIKey | PZXQNKJLMGURJQ-VWNXEWBOSA-N |
| XLogP | 0.09 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.33 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |