C13H27N3O3S — CID 91407841
(2R,3R,4S,5S,6S)-3-acetamido-6-(aminomethyl)-N,4,5-trimethyloxane-2-carboxamide;methanethiol (PubChem CID 91407841) has the molecular formula C13H27N3O3S and a molecular weight of 305.44 g/mol. Its IUPAC name is (2R,3R,4S,5S,6S)-3-acetamido-6-(aminomethyl)-N,4,5-trimethyloxane-2-carboxamide;methanethiol.
| Compound Name | (2R,3R,4S,5S,6S)-3-acetamido-6-(aminomethyl)-N,4,5-trimethyloxane-2-carboxamide;methanethiol |
|---|---|
| PubChem CID | 91407841 |
| Molecular Formula | C13H27N3O3S |
| Molecular Weight | 305.44 g/mol |
| Exact Mass | 305.18 |
| IUPAC Name | (2R,3R,4S,5S,6S)-3-acetamido-6-(aminomethyl)-N,4,5-trimethyloxane-2-carboxamide;methanethiol |
| SMILES | CNC(=O)[C@@H]1O[C@H](CN)[C@@H](C)[C@H](C)[C@H]1NC(C)=O.CS |
| InChI | InChI=1S/C12H23N3O3.CH4S/c1-6-7(2)10(15-8(3)16)11(12(17)14-4)18-9(6)5-13;1-2/h6-7,9-11H,5,13H2,1-4H3,(H,14,17)(H,15,16);2H,1H3/t6-,7-,9+,10+,11+;/m0./s1 |
| InChIKey | HKXPJPDIQATAFM-TYLZWBSQSA-N |
| XLogP | -0.22 |
| TPSA | 93.45 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.44 |
| LogP ≤ 5 | -0.22 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|