About actinium;5-hydroxy-N,3,4-trimethyloxolane-2-carboxamide
actinium;5-hydroxy-N,3,4-trimethyloxolane-2-carboxamide (PubChem CID 23377388) has the molecular formula C8H15AcNO3
and a molecular weight of 400.21 g/mol. Its IUPAC name is actinium;5-hydroxy-N,3,4-trimethyloxolane-2-carboxamide.
Molecular Properties
| Compound Name | actinium;5-hydroxy-N,3,4-trimethyloxolane-2-carboxamide |
| PubChem CID | 23377388 |
| Molecular Formula | C8H15AcNO3 |
| Molecular Weight | 400.21 g/mol |
| Exact Mass | 400.13 |
| IUPAC Name | actinium;5-hydroxy-N,3,4-trimethyloxolane-2-carboxamide |
| SMILES | CNC(=O)C1OC(O)C(C)C1C.[Ac] |
| InChI | InChI=1S/C8H15NO3.Ac/c1-4-5(2)8(11)12-6(4)7(10)9-3;/h4-6,8,11H,1-3H3,(H,9,10); |
| InChIKey | VRADVOIFEKEJKM-UHFFFAOYSA-N |
| XLogP | -0.28 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 400.21 |
| LogP ≤ 5 | -0.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze actinium;5-hydroxy-N,3,4-trimethyloxolane-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of actinium;5-hydroxy-N,3,4-trimethyloxolane-2-carboxamide?
The IUPAC name of actinium;5-hydroxy-N,3,4-trimethyloxolane-2-carboxamide (CID 23377388) is actinium;5-hydroxy-N,3,4-trimethyloxolane-2-carboxamide.
What is the SMILES notation for actinium;5-hydroxy-N,3,4-trimethyloxolane-2-carboxamide?
The canonical SMILES for actinium;5-hydroxy-N,3,4-trimethyloxolane-2-carboxamide is CNC(=O)C1OC(O)C(C)C1C.[Ac].
What is the InChIKey of actinium;5-hydroxy-N,3,4-trimethyloxolane-2-carboxamide?
The InChIKey is VRADVOIFEKEJKM-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H15NO3.Ac/c1-4-5(2)8(11)12-6(4)7(10)9-3;/h4-6,8,11H,1-3H3,(H,9,10);.
What are the key properties of actinium;5-hydroxy-N,3,4-trimethyloxolane-2-carboxamide?
actinium;5-hydroxy-N,3,4-trimethyloxolane-2-carboxamide has a molecular weight of 400.21 g/mol, XLogP of -0.28, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for actinium;5-hydroxy-N,3,4-trimethyloxolane-2-carboxamide is sourced from PubChem (CID 23377388), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).