C22H42N4O5 — CID 91087100
(2R,6S)-N-[[(2S,6R)-5-acetamido-3,4-dimethyl-6-(methylcarbamoyl)oxan-2-yl]methyl]-6-(aminomethyl)-3,4,5-trimethyloxane-2-carboxamide;molecular hydrogen (PubChem CID 91087100) has the molecular formula C22H42N4O5 and a molecular weight of 442.60 g/mol. Its IUPAC name is (2R,6S)-N-[[(2S,6R)-5-acetamido-3,4-dimethyl-6-(methylcarbamoyl)oxan-2-yl]methyl]-6-(aminomethyl)-3,4,5-trimethyloxane-2-carboxamide;molecular hydrogen.
| Compound Name | (2R,6S)-N-[[(2S,6R)-5-acetamido-3,4-dimethyl-6-(methylcarbamoyl)oxan-2-yl]methyl]-6-(aminomethyl)-3,4,5-trimethyloxane-2-carboxamide;molecular hydrogen |
|---|---|
| PubChem CID | 91087100 |
| Molecular Formula | C22H42N4O5 |
| Molecular Weight | 442.60 g/mol |
| Exact Mass | 442.32 |
| IUPAC Name | (2R,6S)-N-[[(2S,6R)-5-acetamido-3,4-dimethyl-6-(methylcarbamoyl)oxan-2-yl]methyl]-6-(aminomethyl)-3,4,5-trimethyloxane-2-carboxamide;molecular hydrogen |
| SMILES | CNC(=O)[C@@H]1O[C@H](CNC(=O)[C@@H]2O[C@H](CN)C(C)C(C)C2C)C(C)C(C)C1NC(C)=O.[H][H] |
| InChI | InChI=1S/C22H40N4O5.H2/c1-10-11(2)16(8-23)30-19(14(10)5)22(29)25-9-17-12(3)13(4)18(26-15(6)27)20(31-17)21(28)24-7;/h10-14,16-20H,8-9,23H2,1-7H3,(H,24,28)(H,25,29)(H,26,27);1H/t10?,11?,12?,13?,14?,16-,17-,18?,19-,20-;/m1./s1 |
| InChIKey | RSXVWMKSAQRACL-ZUPOYILESA-N |
| XLogP | 0.27 |
| TPSA | 131.78 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.60 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |