C11H22N2O5 — CID 71120958
(3S,6R)-6-(aminomethyl)-N-butyl-3,4,5-trihydroxyoxane-2-carboxamide (PubChem CID 71120958) has the molecular formula C11H22N2O5 and a molecular weight of 262.31 g/mol. Its IUPAC name is (3S,6R)-6-(aminomethyl)-N-butyl-3,4,5-trihydroxyoxane-2-carboxamide.
| Compound Name | (3S,6R)-6-(aminomethyl)-N-butyl-3,4,5-trihydroxyoxane-2-carboxamide |
|---|---|
| PubChem CID | 71120958 |
| Molecular Formula | C11H22N2O5 |
| Molecular Weight | 262.31 g/mol |
| Exact Mass | 262.15 |
| IUPAC Name | (3S,6R)-6-(aminomethyl)-N-butyl-3,4,5-trihydroxyoxane-2-carboxamide |
| SMILES | CCCCNC(=O)C1O[C@H](CN)C(O)C(O)[C@@H]1O |
| InChI | InChI=1S/C11H22N2O5/c1-2-3-4-13-11(17)10-9(16)8(15)7(14)6(5-12)18-10/h6-10,14-16H,2-5,12H2,1H3,(H,13,17)/t6-,7?,8?,9+,10?/m1/s1 |
| InChIKey | SXYPIXWEBKYHPZ-HIERMZOSSA-N |
| XLogP | -2.29 |
| TPSA | 125.04 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.31 |
| LogP ≤ 5 | -2.29 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|