C15H29NO7 — CID 98140406
[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-methoxyoxan-2-yl]methyl N-heptylcarbamate (PubChem CID 98140406) has the molecular formula C15H29NO7 and a molecular weight of 335.40 g/mol. Its IUPAC name is [(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-methoxyoxan-2-yl]methyl N-heptylcarbamate.
| Compound Name | [(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-methoxyoxan-2-yl]methyl N-heptylcarbamate |
|---|---|
| PubChem CID | 98140406 |
| Molecular Formula | C15H29NO7 |
| Molecular Weight | 335.40 g/mol |
| Exact Mass | 335.19 |
| IUPAC Name | [(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-methoxyoxan-2-yl]methyl N-heptylcarbamate |
| SMILES | CCCCCCCNC(=O)OC[C@@H]1O[C@@H](OC)[C@@H](O)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C15H29NO7/c1-3-4-5-6-7-8-16-15(20)22-9-10-11(17)12(18)13(19)14(21-2)23-10/h10-14,17-19H,3-9H2,1-2H3,(H,16,20)/t10-,11-,12-,13-,14+/m0/s1 |
| InChIKey | XPIVOYOQXKNYHA-HTVCTNPSSA-N |
| XLogP | 0.14 |
| TPSA | 117.48 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.40 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|