C15H29NO7 — CID 141087416
[(2R,3S,4S,5R,6S)-3,4,5,6-tetrahydroxy-6-methyloxan-2-yl]methyl N-heptylcarbamate (PubChem CID 141087416) has the molecular formula C15H29NO7 and a molecular weight of 335.40 g/mol. Its IUPAC name is [(2R,3S,4S,5R,6S)-3,4,5,6-tetrahydroxy-6-methyloxan-2-yl]methyl N-heptylcarbamate.
| Compound Name | [(2R,3S,4S,5R,6S)-3,4,5,6-tetrahydroxy-6-methyloxan-2-yl]methyl N-heptylcarbamate |
|---|---|
| PubChem CID | 141087416 |
| Molecular Formula | C15H29NO7 |
| Molecular Weight | 335.40 g/mol |
| Exact Mass | 335.19 |
| IUPAC Name | [(2R,3S,4S,5R,6S)-3,4,5,6-tetrahydroxy-6-methyloxan-2-yl]methyl N-heptylcarbamate |
| SMILES | CCCCCCCNC(=O)OC[C@H]1O[C@](C)(O)[C@H](O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C15H29NO7/c1-3-4-5-6-7-8-16-14(20)22-9-10-11(17)12(18)13(19)15(2,21)23-10/h10-13,17-19,21H,3-9H2,1-2H3,(H,16,20)/t10-,11-,12+,13-,15+/m1/s1 |
| InChIKey | AMCAMDBWFHHYMR-VVSAWPALSA-N |
| XLogP | -0.13 |
| TPSA | 128.48 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.40 |
| LogP ≤ 5 | -0.13 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|