C20H37NO8 — CID 67702378
[(2R,3S,4S,5R,6S)-3,4,6-trihydroxy-5-methoxyoxan-2-yl]methyl N-(5-oxododecyl)carbamate (PubChem CID 67702378) has the molecular formula C20H37NO8 and a molecular weight of 419.52 g/mol. Its IUPAC name is [(2R,3S,4S,5R,6S)-3,4,6-trihydroxy-5-methoxyoxan-2-yl]methyl N-(5-oxododecyl)carbamate.
| Compound Name | [(2R,3S,4S,5R,6S)-3,4,6-trihydroxy-5-methoxyoxan-2-yl]methyl N-(5-oxododecyl)carbamate |
|---|---|
| PubChem CID | 67702378 |
| Molecular Formula | C20H37NO8 |
| Molecular Weight | 419.52 g/mol |
| Exact Mass | 419.25 |
| IUPAC Name | [(2R,3S,4S,5R,6S)-3,4,6-trihydroxy-5-methoxyoxan-2-yl]methyl N-(5-oxododecyl)carbamate |
| SMILES | CCCCCCCC(=O)CCCCNC(=O)OC[C@H]1O[C@H](O)[C@H](OC)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C20H37NO8/c1-3-4-5-6-7-10-14(22)11-8-9-12-21-20(26)28-13-15-16(23)17(24)18(27-2)19(25)29-15/h15-19,23-25H,3-13H2,1-2H3,(H,21,26)/t15-,16-,17+,18-,19+/m1/s1 |
| InChIKey | FNIXXHOPEVBUOD-FQBWVUSXSA-N |
| XLogP | 1.27 |
| TPSA | 134.55 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.52 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|