C9H17NO7 — CID 101002627
[(2R,3R,4S,5R)-3,4,5,6-tetrahydroxyoxan-2-yl]methyl N-ethylcarbamate (PubChem CID 101002627) has the molecular formula C9H17NO7 and a molecular weight of 251.23 g/mol. Its IUPAC name is [(2R,3R,4S,5R)-3,4,5,6-tetrahydroxyoxan-2-yl]methyl N-ethylcarbamate.
| Compound Name | [(2R,3R,4S,5R)-3,4,5,6-tetrahydroxyoxan-2-yl]methyl N-ethylcarbamate |
|---|---|
| PubChem CID | 101002627 |
| Molecular Formula | C9H17NO7 |
| Molecular Weight | 251.23 g/mol |
| Exact Mass | 251.10 |
| IUPAC Name | [(2R,3R,4S,5R)-3,4,5,6-tetrahydroxyoxan-2-yl]methyl N-ethylcarbamate |
| SMILES | CCNC(=O)OC[C@H]1OC(O)[C@H](O)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C9H17NO7/c1-2-10-9(15)16-3-4-5(11)6(12)7(13)8(14)17-4/h4-8,11-14H,2-3H2,1H3,(H,10,15)/t4-,5+,6+,7-,8?/m1/s1 |
| InChIKey | RHNZXPPBSMWWAO-XLSKCSLXSA-N |
| XLogP | -2.47 |
| TPSA | 128.48 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.23 |
| LogP ≤ 5 | -2.47 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |