C11H19N3O5S — CID 66551926
[(3aR,5R,6S,7R,7aR)-6,7-dihydroxy-2-(methylamino)-5,6,7,7a-tetrahydro-3aH-pyrano[3,2-d][1,3]thiazol-5-yl]methyl N-ethylcarbamate (PubChem CID 66551926) has the molecular formula C11H19N3O5S and a molecular weight of 305.36 g/mol. Its IUPAC name is [(3aR,5R,6S,7R,7aR)-6,7-dihydroxy-2-(methylamino)-5,6,7,7a-tetrahydro-3aH-pyrano[3,2-d][1,3]thiazol-5-yl]methyl N-ethylcarbamate.
| Compound Name | [(3aR,5R,6S,7R,7aR)-6,7-dihydroxy-2-(methylamino)-5,6,7,7a-tetrahydro-3aH-pyrano[3,2-d][1,3]thiazol-5-yl]methyl N-ethylcarbamate |
|---|---|
| PubChem CID | 66551926 |
| Molecular Formula | C11H19N3O5S |
| Molecular Weight | 305.36 g/mol |
| Exact Mass | 305.10 |
| IUPAC Name | [(3aR,5R,6S,7R,7aR)-6,7-dihydroxy-2-(methylamino)-5,6,7,7a-tetrahydro-3aH-pyrano[3,2-d][1,3]thiazol-5-yl]methyl N-ethylcarbamate |
| SMILES | CCNC(=O)OC[C@H]1O[C@@H]2SC(NC)=N[C@@H]2[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C11H19N3O5S/c1-3-13-11(17)18-4-5-7(15)8(16)6-9(19-5)20-10(12-2)14-6/h5-9,15-16H,3-4H2,1-2H3,(H,12,14)(H,13,17)/t5-,6-,7-,8-,9-/m1/s1 |
| InChIKey | DENDOEMNFYRLBS-JGKVKWKGSA-N |
| XLogP | -1.13 |
| TPSA | 112.41 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.36 |
| LogP ≤ 5 | -1.13 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |