C12H23N3O5S — CID 126606491
[(3aR,5R,6S,7R,7aR)-2-(dimethylamino)-6,7-dihydroxy-2,3a,5,6,7,7a-hexahydro-1H-pyrano[3,2-d][1,3]thiazol-5-yl]methyl N-ethylcarbamate (PubChem CID 126606491) has the molecular formula C12H23N3O5S and a molecular weight of 321.40 g/mol. Its IUPAC name is [(3aR,5R,6S,7R,7aR)-2-(dimethylamino)-6,7-dihydroxy-2,3a,5,6,7,7a-hexahydro-1H-pyrano[3,2-d][1,3]thiazol-5-yl]methyl N-ethylcarbamate.
| Compound Name | [(3aR,5R,6S,7R,7aR)-2-(dimethylamino)-6,7-dihydroxy-2,3a,5,6,7,7a-hexahydro-1H-pyrano[3,2-d][1,3]thiazol-5-yl]methyl N-ethylcarbamate |
|---|---|
| PubChem CID | 126606491 |
| Molecular Formula | C12H23N3O5S |
| Molecular Weight | 321.40 g/mol |
| Exact Mass | 321.14 |
| IUPAC Name | [(3aR,5R,6S,7R,7aR)-2-(dimethylamino)-6,7-dihydroxy-2,3a,5,6,7,7a-hexahydro-1H-pyrano[3,2-d][1,3]thiazol-5-yl]methyl N-ethylcarbamate |
| SMILES | CCNC(=O)OC[C@H]1O[C@@H]2SC(N(C)C)N[C@@H]2[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C12H23N3O5S/c1-4-13-12(18)19-5-6-8(16)9(17)7-10(20-6)21-11(14-7)15(2)3/h6-11,14,16-17H,4-5H2,1-3H3,(H,13,18)/t6-,7-,8-,9-,10-,11?/m1/s1 |
| InChIKey | SRVPMFYGVSZBAV-FWMCJMQLSA-N |
| XLogP | -1.27 |
| TPSA | 103.29 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.40 |
| LogP ≤ 5 | -1.27 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |