C10H18NO9S- — CID 90322093
3-[[(2R,3S,4S,5R)-3,4,5,6-tetrahydroxyoxan-2-yl]methoxycarbonylamino]propane-1-sulfinate (PubChem CID 90322093) has the molecular formula C10H18NO9S- and a molecular weight of 328.32 g/mol. Its IUPAC name is 3-[[(2R,3S,4S,5R)-3,4,5,6-tetrahydroxyoxan-2-yl]methoxycarbonylamino]propane-1-sulfinate.
| Compound Name | 3-[[(2R,3S,4S,5R)-3,4,5,6-tetrahydroxyoxan-2-yl]methoxycarbonylamino]propane-1-sulfinate |
|---|---|
| PubChem CID | 90322093 |
| Molecular Formula | C10H18NO9S- |
| Molecular Weight | 328.32 g/mol |
| Exact Mass | 328.07 |
| IUPAC Name | 3-[[(2R,3S,4S,5R)-3,4,5,6-tetrahydroxyoxan-2-yl]methoxycarbonylamino]propane-1-sulfinate |
| SMILES | O=C(NCCCS(=O)[O-])OC[C@H]1OC(O)[C@H](O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C10H19NO9S/c12-6-5(20-9(15)8(14)7(6)13)4-19-10(16)11-2-1-3-21(17)18/h5-9,12-15H,1-4H2,(H,11,16)(H,17,18)/p-1/t5-,6-,7+,8-,9?/m1/s1 |
| InChIKey | LDRSKQIWALKGKX-LOFWALOHSA-M |
| XLogP | -3.22 |
| TPSA | 168.61 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.32 |
| LogP ≤ 5 | -3.22 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|