[(3R,4R)-3,4,5,6-tetrahydroxyoxan-2-yl]methyl hydrogen sulfite

C6H12O8S — CID 174083205

IUPAC[(3R,4R)-3,4,5,6-tetrahydroxyoxan-2-yl]methyl hydrogen sulfite
SMILESO=S(O)OCC1OC(O)C(O)[C@H](O)[C@H]1O
InChIInChI=1S/C6H12O8S/c7-3-2(1-13-15(11)12)14-6(10)5(9)4(3)8/h2-10H,1H2,(H,11,12)/t2?,3-,4+,5?,6?/m0/s1
InChIKeyIRPZNIDNSRKFKA-ZVGIEJTISA-N
MW244.22 g/mol
LogP-3.06
Rot. Bonds3

About [(3R,4R)-3,4,5,6-tetrahydroxyoxan-2-yl]methyl hydrogen sulfite

[(3R,4R)-3,4,5,6-tetrahydroxyoxan-2-yl]methyl hydrogen sulfite (PubChem CID 174083205) has the molecular formula C6H12O8S and a molecular weight of 244.22 g/mol. Its IUPAC name is [(3R,4R)-3,4,5,6-tetrahydroxyoxan-2-yl]methyl hydrogen sulfite.

Molecular Properties

Compound Name[(3R,4R)-3,4,5,6-tetrahydroxyoxan-2-yl]methyl hydrogen sulfite
PubChem CID174083205
Molecular FormulaC6H12O8S
Molecular Weight244.22 g/mol
Exact Mass244.03
IUPAC Name[(3R,4R)-3,4,5,6-tetrahydroxyoxan-2-yl]methyl hydrogen sulfite
SMILESO=S(O)OCC1OC(O)C(O)[C@H](O)[C@H]1O
InChIInChI=1S/C6H12O8S/c7-3-2(1-13-15(11)12)14-6(10)5(9)4(3)8/h2-10H,1H2,(H,11,12)/t2?,3-,4+,5?,6?/m0/s1
InChIKeyIRPZNIDNSRKFKA-ZVGIEJTISA-N
XLogP-3.06
TPSA136.68 Ų
H-Bond Donors5
H-Bond Acceptors7
Rotatable Bonds3
Heavy Atoms15
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500244.22
LogP ≤ 5-3.06
H-Bond Donors ≤ 55
H-Bond Acceptors ≤ 107

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'sulfinic_acid', 'substructure': 'N/A'}

Analyze [(3R,4R)-3,4,5,6-tetrahydroxyoxan-2-yl]methyl hydrogen sulfite with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of [(3R,4R)-3,4,5,6-tetrahydroxyoxan-2-yl]methyl hydrogen sulfite?
The IUPAC name of [(3R,4R)-3,4,5,6-tetrahydroxyoxan-2-yl]methyl hydrogen sulfite (CID 174083205) is [(3R,4R)-3,4,5,6-tetrahydroxyoxan-2-yl]methyl hydrogen sulfite.
What is the SMILES notation for [(3R,4R)-3,4,5,6-tetrahydroxyoxan-2-yl]methyl hydrogen sulfite?
The canonical SMILES for [(3R,4R)-3,4,5,6-tetrahydroxyoxan-2-yl]methyl hydrogen sulfite is O=S(O)OCC1OC(O)C(O)[C@H](O)[C@H]1O.
What is the InChIKey of [(3R,4R)-3,4,5,6-tetrahydroxyoxan-2-yl]methyl hydrogen sulfite?
The InChIKey is IRPZNIDNSRKFKA-ZVGIEJTISA-N. The full InChI is InChI=1S/C6H12O8S/c7-3-2(1-13-15(11)12)14-6(10)5(9)4(3)8/h2-10H,1H2,(H,11,12)/t2?,3-,4+,5?,6?/m0/s1.
What are the key properties of [(3R,4R)-3,4,5,6-tetrahydroxyoxan-2-yl]methyl hydrogen sulfite?
[(3R,4R)-3,4,5,6-tetrahydroxyoxan-2-yl]methyl hydrogen sulfite has a molecular weight of 244.22 g/mol, XLogP of -3.06, 3 rotatable bonds, 5 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for [(3R,4R)-3,4,5,6-tetrahydroxyoxan-2-yl]methyl hydrogen sulfite is sourced from PubChem (CID 174083205), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).