C6H12O8S — CID 174083205
[(3R,4R)-3,4,5,6-tetrahydroxyoxan-2-yl]methyl hydrogen sulfite (PubChem CID 174083205) has the molecular formula C6H12O8S and a molecular weight of 244.22 g/mol. Its IUPAC name is [(3R,4R)-3,4,5,6-tetrahydroxyoxan-2-yl]methyl hydrogen sulfite.
| Compound Name | [(3R,4R)-3,4,5,6-tetrahydroxyoxan-2-yl]methyl hydrogen sulfite |
|---|---|
| PubChem CID | 174083205 |
| Molecular Formula | C6H12O8S |
| Molecular Weight | 244.22 g/mol |
| Exact Mass | 244.03 |
| IUPAC Name | [(3R,4R)-3,4,5,6-tetrahydroxyoxan-2-yl]methyl hydrogen sulfite |
| SMILES | O=S(O)OCC1OC(O)C(O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C6H12O8S/c7-3-2(1-13-15(11)12)14-6(10)5(9)4(3)8/h2-10H,1H2,(H,11,12)/t2?,3-,4+,5?,6?/m0/s1 |
| InChIKey | IRPZNIDNSRKFKA-ZVGIEJTISA-N |
| XLogP | -3.06 |
| TPSA | 136.68 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.22 |
| LogP ≤ 5 | -3.06 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|