C6H12O9S — CID 71434014
[(2R,3S,4R,5R)-3,4,5,6-tetrahydroxyoxan-2-yl]methyl hydrogen sulfate (PubChem CID 71434014) has the molecular formula C6H12O9S and a molecular weight of 260.22 g/mol. Its IUPAC name is [(2R,3S,4R,5R)-3,4,5,6-tetrahydroxyoxan-2-yl]methyl hydrogen sulfate.
| Compound Name | [(2R,3S,4R,5R)-3,4,5,6-tetrahydroxyoxan-2-yl]methyl hydrogen sulfate |
|---|---|
| PubChem CID | 71434014 |
| Molecular Formula | C6H12O9S |
| Molecular Weight | 260.22 g/mol |
| Exact Mass | 260.02 |
| IUPAC Name | [(2R,3S,4R,5R)-3,4,5,6-tetrahydroxyoxan-2-yl]methyl hydrogen sulfate |
| SMILES | O=S(=O)(O)OC[C@H]1OC(O)[C@H](O)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C6H12O9S/c7-3-2(1-14-16(11,12)13)15-6(10)5(9)4(3)8/h2-10H,1H2,(H,11,12,13)/t2-,3-,4-,5-,6?/m1/s1 |
| InChIKey | OKUVUONOJCDUJY-IVMDWMLBSA-N |
| XLogP | -3.39 |
| TPSA | 153.75 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.22 |
| LogP ≤ 5 | -3.39 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|