C6H12O15S3 — CID 21158814
[(2S,3R,4R,5S,6R)-3,6-dihydroxy-4,5-disulfooxyoxan-2-yl]methyl hydrogen sulfate (PubChem CID 21158814) has the molecular formula C6H12O15S3 and a molecular weight of 420.35 g/mol. Its IUPAC name is [(2S,3R,4R,5S,6R)-3,6-dihydroxy-4,5-disulfooxyoxan-2-yl]methyl hydrogen sulfate.
| Compound Name | [(2S,3R,4R,5S,6R)-3,6-dihydroxy-4,5-disulfooxyoxan-2-yl]methyl hydrogen sulfate |
|---|---|
| PubChem CID | 21158814 |
| Molecular Formula | C6H12O15S3 |
| Molecular Weight | 420.35 g/mol |
| Exact Mass | 419.93 |
| IUPAC Name | [(2S,3R,4R,5S,6R)-3,6-dihydroxy-4,5-disulfooxyoxan-2-yl]methyl hydrogen sulfate |
| SMILES | O=S(=O)(O)OC[C@@H]1O[C@@H](O)[C@@H](OS(=O)(=O)O)[C@H](OS(=O)(=O)O)[C@@H]1O |
| InChI | InChI=1S/C6H12O15S3/c7-3-2(1-18-22(9,10)11)19-6(8)5(21-24(15,16)17)4(3)20-23(12,13)14/h2-8H,1H2,(H,9,10,11)(H,12,13,14)(H,15,16,17)/t2-,3+,4+,5-,6+/m0/s1 |
| InChIKey | GRHWGVDHRAZFMQ-SXUWKVJYSA-N |
| XLogP | -3.74 |
| TPSA | 240.49 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.35 |
| LogP ≤ 5 | -3.74 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|