C6H12O11S2 — CID 18346195
[(2R,3S,4R,5S)-3,5-dihydroxy-2-(sulfooxymethyl)oxan-4-yl] hydrogen sulfate (PubChem CID 18346195) has the molecular formula C6H12O11S2 and a molecular weight of 324.29 g/mol. Its IUPAC name is [(2R,3S,4R,5S)-3,5-dihydroxy-2-(sulfooxymethyl)oxan-4-yl] hydrogen sulfate.
| Compound Name | [(2R,3S,4R,5S)-3,5-dihydroxy-2-(sulfooxymethyl)oxan-4-yl] hydrogen sulfate |
|---|---|
| PubChem CID | 18346195 |
| Molecular Formula | C6H12O11S2 |
| Molecular Weight | 324.29 g/mol |
| Exact Mass | 323.98 |
| IUPAC Name | [(2R,3S,4R,5S)-3,5-dihydroxy-2-(sulfooxymethyl)oxan-4-yl] hydrogen sulfate |
| SMILES | O=S(=O)(O)OC[C@H]1OC[C@H](O)[C@@H](OS(=O)(=O)O)[C@H]1O |
| InChI | InChI=1S/C6H12O11S2/c7-3-1-15-4(2-16-18(9,10)11)5(8)6(3)17-19(12,13)14/h3-8H,1-2H2,(H,9,10,11)(H,12,13,14)/t3-,4+,5-,6+/m0/s1 |
| InChIKey | JNTBPYHODDRFEK-BGPJRJDNSA-N |
| XLogP | -2.89 |
| TPSA | 176.89 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.29 |
| LogP ≤ 5 | -2.89 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|