C13H18O12S2 — CID 11627018
[(2S,3R,4S,5R,6R)-2,5-dihydroxy-3-phenylmethoxy-6-(sulfooxymethyl)oxan-4-yl] hydrogen sulfate (PubChem CID 11627018) has the molecular formula C13H18O12S2 and a molecular weight of 430.41 g/mol. Its IUPAC name is [(2S,3R,4S,5R,6R)-2,5-dihydroxy-3-phenylmethoxy-6-(sulfooxymethyl)oxan-4-yl] hydrogen sulfate.
| Compound Name | [(2S,3R,4S,5R,6R)-2,5-dihydroxy-3-phenylmethoxy-6-(sulfooxymethyl)oxan-4-yl] hydrogen sulfate |
|---|---|
| PubChem CID | 11627018 |
| Molecular Formula | C13H18O12S2 |
| Molecular Weight | 430.41 g/mol |
| Exact Mass | 430.02 |
| IUPAC Name | [(2S,3R,4S,5R,6R)-2,5-dihydroxy-3-phenylmethoxy-6-(sulfooxymethyl)oxan-4-yl] hydrogen sulfate |
| SMILES | O=S(=O)(O)OC[C@H]1O[C@H](O)[C@H](OCc2ccccc2)[C@@H](OS(=O)(=O)O)[C@@H]1O |
| InChI | InChI=1S/C13H18O12S2/c14-10-9(7-23-26(16,17)18)24-13(15)12(11(10)25-27(19,20)21)22-6-8-4-2-1-3-5-8/h1-5,9-15H,6-7H2,(H,16,17,18)(H,19,20,21)/t9-,10-,11+,12-,13+/m1/s1 |
| InChIKey | LHLCNLCMMMRCBZ-LBELIVKGSA-N |
| XLogP | -1.34 |
| TPSA | 186.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.41 |
| LogP ≤ 5 | -1.34 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|