C13H16Na2O12S2 — CID 11627017
disodium;[(2S,3R,4S,5R,6R)-2,5-dihydroxy-3-phenylmethoxy-6-(sulfonatooxymethyl)oxan-4-yl] sulfate (PubChem CID 11627017) has the molecular formula C13H16Na2O12S2 and a molecular weight of 474.37 g/mol. Its IUPAC name is disodium;[(2S,3R,4S,5R,6R)-2,5-dihydroxy-3-phenylmethoxy-6-(sulfonatooxymethyl)oxan-4-yl] sulfate.
| Compound Name | disodium;[(2S,3R,4S,5R,6R)-2,5-dihydroxy-3-phenylmethoxy-6-(sulfonatooxymethyl)oxan-4-yl] sulfate |
|---|---|
| PubChem CID | 11627017 |
| Molecular Formula | C13H16Na2O12S2 |
| Molecular Weight | 474.37 g/mol |
| Exact Mass | 473.99 |
| IUPAC Name | disodium;[(2S,3R,4S,5R,6R)-2,5-dihydroxy-3-phenylmethoxy-6-(sulfonatooxymethyl)oxan-4-yl] sulfate |
| SMILES | O=S(=O)([O-])OC[C@H]1O[C@H](O)[C@H](OCc2ccccc2)[C@@H](OS(=O)(=O)[O-])[C@@H]1O.[Na+].[Na+] |
| InChI | InChI=1S/C13H18O12S2.2Na/c14-10-9(7-23-26(16,17)18)24-13(15)12(11(10)25-27(19,20)21)22-6-8-4-2-1-3-5-8;;/h1-5,9-15H,6-7H2,(H,16,17,18)(H,19,20,21);;/q;2*+1/p-2/t9-,10-,11+,12-,13+;;/m1../s1 |
| InChIKey | DWCHHLFGNUGZEZ-HEDIUQQLSA-L |
| XLogP | -8.02 |
| TPSA | 191.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.37 |
| LogP ≤ 5 | -8.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|