C13H18O9S — CID 102591291
[(2R,3R,4R,5R,6R)-4,5-dihydroxy-2-(hydroxymethyl)-6-phenylmethoxyoxan-3-yl] hydrogen sulfate (PubChem CID 102591291) has the molecular formula C13H18O9S and a molecular weight of 350.35 g/mol. Its IUPAC name is [(2R,3R,4R,5R,6R)-4,5-dihydroxy-2-(hydroxymethyl)-6-phenylmethoxyoxan-3-yl] hydrogen sulfate.
| Compound Name | [(2R,3R,4R,5R,6R)-4,5-dihydroxy-2-(hydroxymethyl)-6-phenylmethoxyoxan-3-yl] hydrogen sulfate |
|---|---|
| PubChem CID | 102591291 |
| Molecular Formula | C13H18O9S |
| Molecular Weight | 350.35 g/mol |
| Exact Mass | 350.07 |
| IUPAC Name | [(2R,3R,4R,5R,6R)-4,5-dihydroxy-2-(hydroxymethyl)-6-phenylmethoxyoxan-3-yl] hydrogen sulfate |
| SMILES | O=S(=O)(O)O[C@@H]1[C@H](O)[C@@H](O)[C@H](OCc2ccccc2)O[C@@H]1CO |
| InChI | InChI=1S/C13H18O9S/c14-6-9-12(22-23(17,18)19)10(15)11(16)13(21-9)20-7-8-4-2-1-3-5-8/h1-5,9-16H,6-7H2,(H,17,18,19)/t9-,10-,11-,12+,13-/m1/s1 |
| InChIKey | WPTUWRLWLJHBCU-NJMOYASZSA-N |
| XLogP | -1.17 |
| TPSA | 142.75 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.35 |
| LogP ≤ 5 | -1.17 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|