C48H54O17S2 — CID 10843659
[(2R,3R,4S,5R,6R)-6-[(2R,3R,4S,5R,6R)-6-methoxy-4,5-bis(phenylmethoxy)-2-(sulfooxymethyl)oxan-3-yl]oxy-3,4,5-tris(phenylmethoxy)oxan-2-yl]methyl hydrogen sulfate (PubChem CID 10843659) has the molecular formula C48H54O17S2 and a molecular weight of 967.08 g/mol. Its IUPAC name is [(2R,3R,4S,5R,6R)-6-[(2R,3R,4S,5R,6R)-6-methoxy-4,5-bis(phenylmethoxy)-2-(sulfooxymethyl)oxan-3-yl]oxy-3,4,5-tris(phenylmethoxy)oxan-2-yl]methyl hydrogen sulfate.
| Compound Name | [(2R,3R,4S,5R,6R)-6-[(2R,3R,4S,5R,6R)-6-methoxy-4,5-bis(phenylmethoxy)-2-(sulfooxymethyl)oxan-3-yl]oxy-3,4,5-tris(phenylmethoxy)oxan-2-yl]methyl hydrogen sulfate |
|---|---|
| PubChem CID | 10843659 |
| Molecular Formula | C48H54O17S2 |
| Molecular Weight | 967.08 g/mol |
| Exact Mass | 966.28 |
| IUPAC Name | [(2R,3R,4S,5R,6R)-6-[(2R,3R,4S,5R,6R)-6-methoxy-4,5-bis(phenylmethoxy)-2-(sulfooxymethyl)oxan-3-yl]oxy-3,4,5-tris(phenylmethoxy)oxan-2-yl]methyl hydrogen sulfate |
| SMILES | CO[C@@H]1O[C@H](COS(=O)(=O)O)[C@@H](O[C@H]2O[C@H](COS(=O)(=O)O)[C@@H](OCc3ccccc3)[C@H](OCc3ccccc3)[C@H]2OCc2ccccc2)[C@H](OCc2ccccc2)[C@H]1OCc1ccccc1 |
| InChI | InChI=1S/C48H54O17S2/c1-55-47-45(59-30-37-23-13-5-14-24-37)44(58-29-36-21-11-4-12-22-36)42(40(63-47)33-62-67(52,53)54)65-48-46(60-31-38-25-15-6-16-26-38)43(57-28-35-19-9-3-10-20-35)41(39(64-48)32-61-66(49,50)51)56-27-34-17-7-2-8-18-34/h2-26,39-48H,27-33H2,1H3,(H,49,50,51)(H,52,53,54)/t39-,40-,41-,42-,43+,44+,45-,46-,47-,48-/m1/s1 |
| InChIKey | WJRAKDPEPHPWMG-BGSAPFNFSA-N |
| XLogP | 6.03 |
| TPSA | 210.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 67 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 967.08 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|