C6H13NO13S3 — CID 88909075
[(4S,5R)-5-hydroxy-4-sulfooxy-6-(sulfooxymethyl)oxan-3-yl]sulfamic acid (PubChem CID 88909075) has the molecular formula C6H13NO13S3 and a molecular weight of 403.37 g/mol. Its IUPAC name is [(4S,5R)-5-hydroxy-4-sulfooxy-6-(sulfooxymethyl)oxan-3-yl]sulfamic acid.
| Compound Name | [(4S,5R)-5-hydroxy-4-sulfooxy-6-(sulfooxymethyl)oxan-3-yl]sulfamic acid |
|---|---|
| PubChem CID | 88909075 |
| Molecular Formula | C6H13NO13S3 |
| Molecular Weight | 403.37 g/mol |
| Exact Mass | 402.95 |
| IUPAC Name | [(4S,5R)-5-hydroxy-4-sulfooxy-6-(sulfooxymethyl)oxan-3-yl]sulfamic acid |
| SMILES | O=S(=O)(O)NC1COC(COS(=O)(=O)O)[C@@H](O)[C@H]1OS(=O)(=O)O |
| InChI | InChI=1S/C6H13NO13S3/c8-5-4(2-19-22(12,13)14)18-1-3(7-21(9,10)11)6(5)20-23(15,16)17/h3-8H,1-2H2,(H,9,10,11)(H,12,13,14)(H,15,16,17)/t3?,4?,5-,6+/m1/s1 |
| InChIKey | LAYLYRGOYYDQGK-KTGMNZKDSA-N |
| XLogP | -3.49 |
| TPSA | 223.06 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.37 |
| LogP ≤ 5 | -3.49 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|