C6H13NO9S2 — CID 58596078
[(4S)-4-hydroxy-6-(sulfooxymethyl)oxan-3-yl]sulfamic acid (PubChem CID 58596078) has the molecular formula C6H13NO9S2 and a molecular weight of 307.30 g/mol. Its IUPAC name is [(4S)-4-hydroxy-6-(sulfooxymethyl)oxan-3-yl]sulfamic acid.
| Compound Name | [(4S)-4-hydroxy-6-(sulfooxymethyl)oxan-3-yl]sulfamic acid |
|---|---|
| PubChem CID | 58596078 |
| Molecular Formula | C6H13NO9S2 |
| Molecular Weight | 307.30 g/mol |
| Exact Mass | 307.00 |
| IUPAC Name | [(4S)-4-hydroxy-6-(sulfooxymethyl)oxan-3-yl]sulfamic acid |
| SMILES | O=S(=O)(O)NC1COC(COS(=O)(=O)O)C[C@@H]1O |
| InChI | InChI=1S/C6H13NO9S2/c8-6-1-4(2-16-18(12,13)14)15-3-5(6)7-17(9,10)11/h4-8H,1-3H2,(H,9,10,11)(H,12,13,14)/t4?,5?,6-/m0/s1 |
| InChIKey | VRWXBKDGFSKQFZ-WRVKLSGPSA-N |
| XLogP | -2.28 |
| TPSA | 159.46 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.30 |
| LogP ≤ 5 | -2.28 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|