C12H25NO7S — CID 59093023
[5-(hexylamino)-4,6-dihydroxyoxan-2-yl]methyl hydrogen sulfate (PubChem CID 59093023) has the molecular formula C12H25NO7S and a molecular weight of 327.40 g/mol. Its IUPAC name is [5-(hexylamino)-4,6-dihydroxyoxan-2-yl]methyl hydrogen sulfate.
| Compound Name | [5-(hexylamino)-4,6-dihydroxyoxan-2-yl]methyl hydrogen sulfate |
|---|---|
| PubChem CID | 59093023 |
| Molecular Formula | C12H25NO7S |
| Molecular Weight | 327.40 g/mol |
| Exact Mass | 327.14 |
| IUPAC Name | [5-(hexylamino)-4,6-dihydroxyoxan-2-yl]methyl hydrogen sulfate |
| SMILES | CCCCCCNC1C(O)CC(COS(=O)(=O)O)OC1O |
| InChI | InChI=1S/C12H25NO7S/c1-2-3-4-5-6-13-11-10(14)7-9(20-12(11)15)8-19-21(16,17)18/h9-15H,2-8H2,1H3,(H,16,17,18) |
| InChIKey | GAFCEIXZAGFHSQ-UHFFFAOYSA-N |
| XLogP | -0.19 |
| TPSA | 125.32 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.40 |
| LogP ≤ 5 | -0.19 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|