C14H27NO5 — CID 123488014
N-[2,4-dihydroxy-6-(hydroxymethyl)oxan-3-yl]octanamide (PubChem CID 123488014) has the molecular formula C14H27NO5 and a molecular weight of 289.37 g/mol. Its IUPAC name is N-[2,4-dihydroxy-6-(hydroxymethyl)oxan-3-yl]octanamide.
| Compound Name | N-[2,4-dihydroxy-6-(hydroxymethyl)oxan-3-yl]octanamide |
|---|---|
| PubChem CID | 123488014 |
| Molecular Formula | C14H27NO5 |
| Molecular Weight | 289.37 g/mol |
| Exact Mass | 289.19 |
| IUPAC Name | N-[2,4-dihydroxy-6-(hydroxymethyl)oxan-3-yl]octanamide |
| SMILES | CCCCCCCC(=O)NC1C(O)CC(CO)OC1O |
| InChI | InChI=1S/C14H27NO5/c1-2-3-4-5-6-7-12(18)15-13-11(17)8-10(9-16)20-14(13)19/h10-11,13-14,16-17,19H,2-9H2,1H3,(H,15,18) |
| InChIKey | ZPRRBOLDTPPWLI-UHFFFAOYSA-N |
| XLogP | 0.29 |
| TPSA | 99.02 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.37 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|