C19H37NO5 — CID 155614587
N-[(2S,4R,5S)-4,5-dihydroxy-6-(hydroxymethyl)-2-propan-2-yloxan-3-yl]decanamide (PubChem CID 155614587) has the molecular formula C19H37NO5 and a molecular weight of 359.51 g/mol. Its IUPAC name is N-[(2S,4R,5S)-4,5-dihydroxy-6-(hydroxymethyl)-2-propan-2-yloxan-3-yl]decanamide.
| Compound Name | N-[(2S,4R,5S)-4,5-dihydroxy-6-(hydroxymethyl)-2-propan-2-yloxan-3-yl]decanamide |
|---|---|
| PubChem CID | 155614587 |
| Molecular Formula | C19H37NO5 |
| Molecular Weight | 359.51 g/mol |
| Exact Mass | 359.27 |
| IUPAC Name | N-[(2S,4R,5S)-4,5-dihydroxy-6-(hydroxymethyl)-2-propan-2-yloxan-3-yl]decanamide |
| SMILES | CCCCCCCCCC(=O)NC1[C@H](C(C)C)OC(CO)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C19H37NO5/c1-4-5-6-7-8-9-10-11-15(22)20-16-18(24)17(23)14(12-21)25-19(16)13(2)3/h13-14,16-19,21,23-24H,4-12H2,1-3H3,(H,20,22)/t14?,16?,17-,18-,19+/m1/s1 |
| InChIKey | XFNLPBOKDFEVOQ-XXXOSLHZSA-N |
| XLogP | 1.75 |
| TPSA | 99.02 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.51 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|