C25H46N2O7 — CID 123527153
N-[2-[[4,5-dihydroxy-6-(hydroxymethyl)-2-methoxyoxan-3-yl]amino]-2-oxoethyl]hexadec-9-enamide (PubChem CID 123527153) has the molecular formula C25H46N2O7 and a molecular weight of 486.65 g/mol. Its IUPAC name is N-[2-[[4,5-dihydroxy-6-(hydroxymethyl)-2-methoxyoxan-3-yl]amino]-2-oxoethyl]hexadec-9-enamide.
| Compound Name | N-[2-[[4,5-dihydroxy-6-(hydroxymethyl)-2-methoxyoxan-3-yl]amino]-2-oxoethyl]hexadec-9-enamide |
|---|---|
| PubChem CID | 123527153 |
| Molecular Formula | C25H46N2O7 |
| Molecular Weight | 486.65 g/mol |
| Exact Mass | 486.33 |
| IUPAC Name | N-[2-[[4,5-dihydroxy-6-(hydroxymethyl)-2-methoxyoxan-3-yl]amino]-2-oxoethyl]hexadec-9-enamide |
| SMILES | CCCCCCC=CCCCCCCCC(=O)NCC(=O)NC1C(OC)OC(CO)C(O)C1O |
| InChI | InChI=1S/C25H46N2O7/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-20(29)26-17-21(30)27-22-24(32)23(31)19(18-28)34-25(22)33-2/h8-9,19,22-25,28,31-32H,3-7,10-18H2,1-2H3,(H,26,29)(H,27,30) |
| InChIKey | DIPBAJNDWPERRR-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 137.35 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.65 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|