C24H44N2O8 — CID 163805417
(Z)-N-[2-[[4,5-dihydroxy-6-(hydroxymethyl)-2-methoxyoxan-3-yl]amino]-2-oxoethyl]-15-hydroxypentadec-9-enamide (PubChem CID 163805417) has the molecular formula C24H44N2O8 and a molecular weight of 488.62 g/mol. Its IUPAC name is (Z)-N-[2-[[4,5-dihydroxy-6-(hydroxymethyl)-2-methoxyoxan-3-yl]amino]-2-oxoethyl]-15-hydroxypentadec-9-enamide.
| Compound Name | (Z)-N-[2-[[4,5-dihydroxy-6-(hydroxymethyl)-2-methoxyoxan-3-yl]amino]-2-oxoethyl]-15-hydroxypentadec-9-enamide |
|---|---|
| PubChem CID | 163805417 |
| Molecular Formula | C24H44N2O8 |
| Molecular Weight | 488.62 g/mol |
| Exact Mass | 488.31 |
| IUPAC Name | (Z)-N-[2-[[4,5-dihydroxy-6-(hydroxymethyl)-2-methoxyoxan-3-yl]amino]-2-oxoethyl]-15-hydroxypentadec-9-enamide |
| SMILES | COC1OC(CO)C(O)C(O)C1NC(=O)CNC(=O)CCCCCCC/C=C\CCCCCO |
| InChI | InChI=1S/C24H44N2O8/c1-33-24-21(23(32)22(31)18(17-28)34-24)26-20(30)16-25-19(29)14-12-10-8-6-4-2-3-5-7-9-11-13-15-27/h3,5,18,21-24,27-28,31-32H,2,4,6-17H2,1H3,(H,25,29)(H,26,30)/b5-3- |
| InChIKey | NIPLPDHWXIWYJZ-HYXAFXHYSA-N |
| XLogP | 0.51 |
| TPSA | 157.58 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.62 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|