C8H15NO7S — CID 59011015
[(4S)-5-acetamido-4-hydroxyoxan-2-yl]methyl hydrogen sulfate (PubChem CID 59011015) has the molecular formula C8H15NO7S and a molecular weight of 269.27 g/mol. Its IUPAC name is [(4S)-5-acetamido-4-hydroxyoxan-2-yl]methyl hydrogen sulfate.
| Compound Name | [(4S)-5-acetamido-4-hydroxyoxan-2-yl]methyl hydrogen sulfate |
|---|---|
| PubChem CID | 59011015 |
| Molecular Formula | C8H15NO7S |
| Molecular Weight | 269.27 g/mol |
| Exact Mass | 269.06 |
| IUPAC Name | [(4S)-5-acetamido-4-hydroxyoxan-2-yl]methyl hydrogen sulfate |
| SMILES | CC(=O)NC1COC(COS(=O)(=O)O)C[C@@H]1O |
| InChI | InChI=1S/C8H15NO7S/c1-5(10)9-7-4-15-6(2-8(7)11)3-16-17(12,13)14/h6-8,11H,2-4H2,1H3,(H,9,10)(H,12,13,14)/t6?,7?,8-/m0/s1 |
| InChIKey | VRUWVAKQRFFPAM-RRQHEKLDSA-N |
| XLogP | -1.54 |
| TPSA | 122.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.27 |
| LogP ≤ 5 | -1.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|