tert-butyl N-[(3S,4R,6R)-6-ethyl-4-hydroxyoxan-3-yl]carbamate

C12H23NO4 — CID 170391498

IUPACtert-butyl N-[(3S,4R,6R)-6-ethyl-4-hydroxyoxan-3-yl]carbamate
SMILESCC[C@@H]1C[C@@H](O)[C@@H](NC(=O)OC(C)(C)C)CO1
InChIInChI=1S/C12H23NO4/c1-5-8-6-10(14)9(7-16-8)13-11(15)17-12(2,3)4/h8-10,14H,5-7H2,1-4H3,(H,13,15)/t8-,9+,10-/m1/s1
InChIKeyLIIPFHMGURWKBW-KXUCPTDWSA-N
MW245.32 g/mol
LogP1.44
Rot. Bonds2

About tert-butyl N-[(3S,4R,6R)-6-ethyl-4-hydroxyoxan-3-yl]carbamate

tert-butyl N-[(3S,4R,6R)-6-ethyl-4-hydroxyoxan-3-yl]carbamate (PubChem CID 170391498) has the molecular formula C12H23NO4 and a molecular weight of 245.32 g/mol. Its IUPAC name is tert-butyl N-[(3S,4R,6R)-6-ethyl-4-hydroxyoxan-3-yl]carbamate.

Molecular Properties

Compound Nametert-butyl N-[(3S,4R,6R)-6-ethyl-4-hydroxyoxan-3-yl]carbamate
PubChem CID170391498
Molecular FormulaC12H23NO4
Molecular Weight245.32 g/mol
Exact Mass245.16
IUPAC Nametert-butyl N-[(3S,4R,6R)-6-ethyl-4-hydroxyoxan-3-yl]carbamate
SMILESCC[C@@H]1C[C@@H](O)[C@@H](NC(=O)OC(C)(C)C)CO1
InChIInChI=1S/C12H23NO4/c1-5-8-6-10(14)9(7-16-8)13-11(15)17-12(2,3)4/h8-10,14H,5-7H2,1-4H3,(H,13,15)/t8-,9+,10-/m1/s1
InChIKeyLIIPFHMGURWKBW-KXUCPTDWSA-N
XLogP1.44
TPSA67.79 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds2
Heavy Atoms17
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500245.32
LogP ≤ 51.44
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Analyze tert-butyl N-[(3S,4R,6R)-6-ethyl-4-hydroxyoxan-3-yl]carbamate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of tert-butyl N-[(3S,4R,6R)-6-ethyl-4-hydroxyoxan-3-yl]carbamate?
The IUPAC name of tert-butyl N-[(3S,4R,6R)-6-ethyl-4-hydroxyoxan-3-yl]carbamate (CID 170391498) is tert-butyl N-[(3S,4R,6R)-6-ethyl-4-hydroxyoxan-3-yl]carbamate.
What is the SMILES notation for tert-butyl N-[(3S,4R,6R)-6-ethyl-4-hydroxyoxan-3-yl]carbamate?
The canonical SMILES for tert-butyl N-[(3S,4R,6R)-6-ethyl-4-hydroxyoxan-3-yl]carbamate is CC[C@@H]1C[C@@H](O)[C@@H](NC(=O)OC(C)(C)C)CO1.
What is the InChIKey of tert-butyl N-[(3S,4R,6R)-6-ethyl-4-hydroxyoxan-3-yl]carbamate?
The InChIKey is LIIPFHMGURWKBW-KXUCPTDWSA-N. The full InChI is InChI=1S/C12H23NO4/c1-5-8-6-10(14)9(7-16-8)13-11(15)17-12(2,3)4/h8-10,14H,5-7H2,1-4H3,(H,13,15)/t8-,9+,10-/m1/s1.
What are the key properties of tert-butyl N-[(3S,4R,6R)-6-ethyl-4-hydroxyoxan-3-yl]carbamate?
tert-butyl N-[(3S,4R,6R)-6-ethyl-4-hydroxyoxan-3-yl]carbamate has a molecular weight of 245.32 g/mol, XLogP of 1.44, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl N-[(3S,4R,6R)-6-ethyl-4-hydroxyoxan-3-yl]carbamate is sourced from PubChem (CID 170391498), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).