About tert-butyl N-[(3S,4R)-4-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-hydroxyoxolan-3-yl]carbamate
tert-butyl N-[(3S,4R)-4-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-hydroxyoxolan-3-yl]carbamate (PubChem CID 10936954) has the molecular formula C16H33NO5Si
and a molecular weight of 347.53 g/mol. Its IUPAC name is tert-butyl N-[(3S,4R)-4-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-hydroxyoxolan-3-yl]carbamate.
Molecular Properties
| Compound Name | tert-butyl N-[(3S,4R)-4-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-hydroxyoxolan-3-yl]carbamate |
| PubChem CID | 10936954 |
| Molecular Formula | C16H33NO5Si |
| Molecular Weight | 347.53 g/mol |
| Exact Mass | 347.21 |
| IUPAC Name | tert-butyl N-[(3S,4R)-4-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-hydroxyoxolan-3-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@@H]1COC(O)[C@H]1CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C16H33NO5Si/c1-15(2,3)22-14(19)17-12-10-20-13(18)11(12)9-21-23(7,8)16(4,5)6/h11-13,18H,9-10H2,1-8H3,(H,17,19)/t11-,12+,13?/m0/s1 |
| InChIKey | QQGFFXDAEQQOGC-LAGVYOHYSA-N |
| XLogP | 2.87 |
| TPSA | 77.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 347.53 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl N-[(3S,4R)-4-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-hydroxyoxolan-3-yl]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl N-[(3S,4R)-4-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-hydroxyoxolan-3-yl]carbamate?
The IUPAC name of tert-butyl N-[(3S,4R)-4-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-hydroxyoxolan-3-yl]carbamate (CID 10936954) is tert-butyl N-[(3S,4R)-4-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-hydroxyoxolan-3-yl]carbamate.
What is the SMILES notation for tert-butyl N-[(3S,4R)-4-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-hydroxyoxolan-3-yl]carbamate?
The canonical SMILES for tert-butyl N-[(3S,4R)-4-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-hydroxyoxolan-3-yl]carbamate is CC(C)(C)OC(=O)N[C@@H]1COC(O)[C@H]1CO[Si](C)(C)C(C)(C)C.
What is the InChIKey of tert-butyl N-[(3S,4R)-4-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-hydroxyoxolan-3-yl]carbamate?
The InChIKey is QQGFFXDAEQQOGC-LAGVYOHYSA-N. The full InChI is InChI=1S/C16H33NO5Si/c1-15(2,3)22-14(19)17-12-10-20-13(18)11(12)9-21-23(7,8)16(4,5)6/h11-13,18H,9-10H2,1-8H3,(H,17,19)/t11-,12+,13?/m0/s1.
What are the key properties of tert-butyl N-[(3S,4R)-4-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-hydroxyoxolan-3-yl]carbamate?
tert-butyl N-[(3S,4R)-4-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-hydroxyoxolan-3-yl]carbamate has a molecular weight of 347.53 g/mol, XLogP of 2.87, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl N-[(3S,4R)-4-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-hydroxyoxolan-3-yl]carbamate is sourced from PubChem (CID 10936954), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).