C16H33NO5Si — CID 10936954
tert-butyl N-[(3S,4R)-4-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-hydroxyoxolan-3-yl]carbamate (PubChem CID 10936954) has the molecular formula C16H33NO5Si and a molecular weight of 347.53 g/mol. Its IUPAC name is tert-butyl N-[(3S,4R)-4-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-hydroxyoxolan-3-yl]carbamate.
| Compound Name | tert-butyl N-[(3S,4R)-4-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-hydroxyoxolan-3-yl]carbamate |
|---|---|
| PubChem CID | 10936954 |
| Molecular Formula | C16H33NO5Si |
| Molecular Weight | 347.53 g/mol |
| Exact Mass | 347.21 |
| IUPAC Name | tert-butyl N-[(3S,4R)-4-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-hydroxyoxolan-3-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@@H]1COC(O)[C@H]1CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C16H33NO5Si/c1-15(2,3)22-14(19)17-12-10-20-13(18)11(12)9-21-23(7,8)16(4,5)6/h11-13,18H,9-10H2,1-8H3,(H,17,19)/t11-,12+,13?/m0/s1 |
| InChIKey | QQGFFXDAEQQOGC-LAGVYOHYSA-N |
| XLogP | 2.87 |
| TPSA | 77.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.53 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|