C12H25IO3Si — CID 10595438
(3S,4R,5R)-4-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-(iodomethyl)oxolan-3-ol (PubChem CID 10595438) has the molecular formula C12H25IO3Si and a molecular weight of 372.32 g/mol. Its IUPAC name is (3S,4R,5R)-4-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-(iodomethyl)oxolan-3-ol.
| Compound Name | (3S,4R,5R)-4-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-(iodomethyl)oxolan-3-ol |
|---|---|
| PubChem CID | 10595438 |
| Molecular Formula | C12H25IO3Si |
| Molecular Weight | 372.32 g/mol |
| Exact Mass | 372.06 |
| IUPAC Name | (3S,4R,5R)-4-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-(iodomethyl)oxolan-3-ol |
| SMILES | CC(C)(C)[Si](C)(C)OC[C@@H]1[C@H](O)CO[C@H]1CI |
| InChI | InChI=1S/C12H25IO3Si/c1-12(2,3)17(4,5)16-7-9-10(14)8-15-11(9)6-13/h9-11,14H,6-8H2,1-5H3/t9-,10-,11+/m1/s1 |
| InChIKey | GSHDXYVCWDHPJY-MXWKQRLJSA-N |
| XLogP | 2.82 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.32 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|