C13H25NO5Si — CID 102359701
(1R,2R,4R,5R,6S)-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-nitro-7-oxabicyclo[2.2.1]heptan-2-ol (PubChem CID 102359701) has the molecular formula C13H25NO5Si and a molecular weight of 303.43 g/mol. Its IUPAC name is (1R,2R,4R,5R,6S)-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-nitro-7-oxabicyclo[2.2.1]heptan-2-ol.
| Compound Name | (1R,2R,4R,5R,6S)-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-nitro-7-oxabicyclo[2.2.1]heptan-2-ol |
|---|---|
| PubChem CID | 102359701 |
| Molecular Formula | C13H25NO5Si |
| Molecular Weight | 303.43 g/mol |
| Exact Mass | 303.15 |
| IUPAC Name | (1R,2R,4R,5R,6S)-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-nitro-7-oxabicyclo[2.2.1]heptan-2-ol |
| SMILES | CC(C)(C)[Si](C)(C)OC[C@H]1[C@H]2O[C@H](C[C@H]2O)[C@@H]1[N+](=O)[O-] |
| InChI | InChI=1S/C13H25NO5Si/c1-13(2,3)20(4,5)18-7-8-11(14(16)17)10-6-9(15)12(8)19-10/h8-12,15H,6-7H2,1-5H3/t8-,9-,10-,11-,12-/m1/s1 |
| InChIKey | RNANRZZAVJTHOK-LZQZFOIKSA-N |
| XLogP | 1.80 |
| TPSA | 81.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.43 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|