C18H29NO5Si — CID 10546950
(2R,3S,4S,5S)-3-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-(furan-2-yl)-2-methyl-4-nitrocyclohexan-1-one (PubChem CID 10546950) has the molecular formula C18H29NO5Si and a molecular weight of 367.52 g/mol. Its IUPAC name is (2R,3S,4S,5S)-3-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-(furan-2-yl)-2-methyl-4-nitrocyclohexan-1-one.
| Compound Name | (2R,3S,4S,5S)-3-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-(furan-2-yl)-2-methyl-4-nitrocyclohexan-1-one |
|---|---|
| PubChem CID | 10546950 |
| Molecular Formula | C18H29NO5Si |
| Molecular Weight | 367.52 g/mol |
| Exact Mass | 367.18 |
| IUPAC Name | (2R,3S,4S,5S)-3-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-(furan-2-yl)-2-methyl-4-nitrocyclohexan-1-one |
| SMILES | C[C@H]1C(=O)C[C@H](c2ccco2)[C@@H]([N+](=O)[O-])[C@H]1CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C18H29NO5Si/c1-12-14(11-24-25(5,6)18(2,3)4)17(19(21)22)13(10-15(12)20)16-8-7-9-23-16/h7-9,12-14,17H,10-11H2,1-6H3/t12-,13-,14+,17-/m1/s1 |
| InChIKey | DPSUJRWRLULUQO-VWPFQQQWSA-N |
| XLogP | 4.26 |
| TPSA | 82.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.52 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|