C20H31NO8Si — CID 102339252
[(3S,6R,7S,8S)-6-[tert-butyl(dimethyl)silyl]oxy-8-(furan-2-yl)-3-methoxy-9-methylidene-7-nitro-2,4-dioxabicyclo[3.3.1]nonan-3-yl]methanol (PubChem CID 102339252) has the molecular formula C20H31NO8Si and a molecular weight of 441.55 g/mol. Its IUPAC name is [(3S,6R,7S,8S)-6-[tert-butyl(dimethyl)silyl]oxy-8-(furan-2-yl)-3-methoxy-9-methylidene-7-nitro-2,4-dioxabicyclo[3.3.1]nonan-3-yl]methanol.
| Compound Name | [(3S,6R,7S,8S)-6-[tert-butyl(dimethyl)silyl]oxy-8-(furan-2-yl)-3-methoxy-9-methylidene-7-nitro-2,4-dioxabicyclo[3.3.1]nonan-3-yl]methanol |
|---|---|
| PubChem CID | 102339252 |
| Molecular Formula | C20H31NO8Si |
| Molecular Weight | 441.55 g/mol |
| Exact Mass | 441.18 |
| IUPAC Name | [(3S,6R,7S,8S)-6-[tert-butyl(dimethyl)silyl]oxy-8-(furan-2-yl)-3-methoxy-9-methylidene-7-nitro-2,4-dioxabicyclo[3.3.1]nonan-3-yl]methanol |
| SMILES | C=C1C2O[C@](CO)(OC)OC1[C@H](O[Si](C)(C)C(C)(C)C)[C@@H]([N+](=O)[O-])[C@@H]2c1ccco1 |
| InChI | InChI=1S/C20H31NO8Si/c1-12-16-14(13-9-8-10-26-13)15(21(23)24)18(29-30(6,7)19(2,3)4)17(12)28-20(11-22,25-5)27-16/h8-10,14-18,22H,1,11H2,2-7H3/t14-,15-,16?,17?,18+,20-/m0/s1 |
| InChIKey | VQPXTXCAUAFBCU-CJOHJOCCSA-N |
| XLogP | 3.05 |
| TPSA | 113.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.55 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|