C19H34O7Si — CID 11429564
(2R,3R,4aS,8R,8aS)-8-[tert-butyl(dimethyl)silyl]oxy-6-(hydroxymethyl)-2,3-dimethoxy-2,3-dimethyl-8,8a-dihydro-4aH-1,4-benzodioxin-5-one (PubChem CID 11429564) has the molecular formula C19H34O7Si and a molecular weight of 402.56 g/mol. Its IUPAC name is (2R,3R,4aS,8R,8aS)-8-[tert-butyl(dimethyl)silyl]oxy-6-(hydroxymethyl)-2,3-dimethoxy-2,3-dimethyl-8,8a-dihydro-4aH-1,4-benzodioxin-5-one.
| Compound Name | (2R,3R,4aS,8R,8aS)-8-[tert-butyl(dimethyl)silyl]oxy-6-(hydroxymethyl)-2,3-dimethoxy-2,3-dimethyl-8,8a-dihydro-4aH-1,4-benzodioxin-5-one |
|---|---|
| PubChem CID | 11429564 |
| Molecular Formula | C19H34O7Si |
| Molecular Weight | 402.56 g/mol |
| Exact Mass | 402.21 |
| IUPAC Name | (2R,3R,4aS,8R,8aS)-8-[tert-butyl(dimethyl)silyl]oxy-6-(hydroxymethyl)-2,3-dimethoxy-2,3-dimethyl-8,8a-dihydro-4aH-1,4-benzodioxin-5-one |
| SMILES | CO[C@]1(C)O[C@H]2[C@H](O[C@@]1(C)OC)C(=O)C(CO)=C[C@H]2O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C19H34O7Si/c1-17(2,3)27(8,9)26-13-10-12(11-20)14(21)16-15(13)24-18(4,22-6)19(5,23-7)25-16/h10,13,15-16,20H,11H2,1-9H3/t13-,15-,16-,18-,19-/m1/s1 |
| InChIKey | SPQOZHLJWLUAHX-IGIMTQTPSA-N |
| XLogP | 2.39 |
| TPSA | 83.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.56 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|